Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2-Naphthyl acetate, 99%
CAS: 1523-11-1 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004060 InChI Key: RJNPPEUAJCEUPV-UHFFFAOYSA-N Synonym: 2-naphthyl acetate,2-acetoxynaphthalene,2-naphthalenol, acetate,beta-naphthyl acetate,2-naphthol, acetate,naphthalene, 2-acetoxy,2-naphthalenol, 2-acetate,.beta.-naphthol acetate,.beta.-naphthyl acetate,o-acetyl-.beta.-naphthol PubChem CID: 73709 IUPAC Name: naphthalen-2-yl acetate SMILES: CC(=O)OC1=CC=C2C=CC=CC2=C1
| PubChem CID | 73709 |
|---|---|
| CAS | 1523-11-1 |
| Molecular Weight (g/mol) | 186.21 |
| MDL Number | MFCD00004060 |
| SMILES | CC(=O)OC1=CC=C2C=CC=CC2=C1 |
| Synonym | 2-naphthyl acetate,2-acetoxynaphthalene,2-naphthalenol, acetate,beta-naphthyl acetate,2-naphthol, acetate,naphthalene, 2-acetoxy,2-naphthalenol, 2-acetate,.beta.-naphthol acetate,.beta.-naphthyl acetate,o-acetyl-.beta.-naphthol |
| IUPAC Name | naphthalen-2-yl acetate |
| InChI Key | RJNPPEUAJCEUPV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
2-Chlorotrityl chloride on polystyrene, 1% cross-linked, 100-200 mesh, 1.0-1.4 mmol/g
CAS: 42074-68-0 Molecular Formula: C19H14Cl2 Molecular Weight (g/mol): 313.221 MDL Number: MFCD00040399 InChI Key: JFLSOKIMYBSASW-UHFFFAOYSA-N Synonym: 2-chlorotrityl chloride,chloro 2-chlorophenyl methylene dibenzene,1-chloro-2-chlorodiphenylmethyl benzene,2-chlorophenyldiphenylmethyl chloride,2-chlorotrityl chloride resin,2-chlorophenyl diphenylmethyl chloride,2-chlorotrityl resin,2-chlorotritylchloride,chloro 2-chlorophenyl diphenylmethane,2-chlorotrityl chloride, polymer-bound PubChem CID: 94524 IUPAC Name: 1-chloro-2-[chloro(diphenyl)methyl]benzene SMILES: C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)Cl
| PubChem CID | 94524 |
|---|---|
| CAS | 42074-68-0 |
| Molecular Weight (g/mol) | 313.221 |
| MDL Number | MFCD00040399 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)Cl |
| Synonym | 2-chlorotrityl chloride,chloro 2-chlorophenyl methylene dibenzene,1-chloro-2-chlorodiphenylmethyl benzene,2-chlorophenyldiphenylmethyl chloride,2-chlorotrityl chloride resin,2-chlorophenyl diphenylmethyl chloride,2-chlorotrityl resin,2-chlorotritylchloride,chloro 2-chlorophenyl diphenylmethane,2-chlorotrityl chloride, polymer-bound |
| IUPAC Name | 1-chloro-2-[chloro(diphenyl)methyl]benzene |
| InChI Key | JFLSOKIMYBSASW-UHFFFAOYSA-N |
| Molecular Formula | C19H14Cl2 |
Vinyltoluene Monomer (m- and p- mixture) (stabilized with TBC) 98.0+%, TCI America™
CAS: 25013-15-4 Molecular Formula: C9H10 MDL Number: MFCD00168066 Synonym: Methylstyrene Monomer
| CAS | 25013-15-4 |
|---|---|
| MDL Number | MFCD00168066 |
| Synonym | Methylstyrene Monomer |
| Molecular Formula | C9H10 |
1-Hexanethiol, 96%
CAS: 111-31-9 Molecular Formula: C6H14S Molecular Weight (g/mol): 118.24 MDL Number: MFCD00004909 InChI Key: PMBXCGGQNSVESQ-UHFFFAOYSA-N Synonym: 1-hexanethiol,hexyl mercaptan,n-hexyl mercaptan,hexanethiol,1-hexylthiol,1-mercaptohexane,hexylthiol,n-hexanethiol,n-hexylthiol,n-hexylmercaptan PubChem CID: 8106 IUPAC Name: hexane-1-thiol SMILES: CCCCCCS
| PubChem CID | 8106 |
|---|---|
| CAS | 111-31-9 |
| Molecular Weight (g/mol) | 118.24 |
| MDL Number | MFCD00004909 |
| SMILES | CCCCCCS |
| Synonym | 1-hexanethiol,hexyl mercaptan,n-hexyl mercaptan,hexanethiol,1-hexylthiol,1-mercaptohexane,hexylthiol,n-hexanethiol,n-hexylthiol,n-hexylmercaptan |
| IUPAC Name | hexane-1-thiol |
| InChI Key | PMBXCGGQNSVESQ-UHFFFAOYSA-N |
| Molecular Formula | C6H14S |
3-Chloropyridine, 99%
CAS: 626-60-8 Molecular Formula: C5H4ClN Molecular Weight (g/mol): 113.54 MDL Number: MFCD00006375 InChI Key: PWRBCZZQRRPXAB-UHFFFAOYSA-N Synonym: pyridine, 3-chloro,m-chloropyridine,unii-1m13huc1p4,ccris 1715,chloropyridine,b-chloropyridine,3-chloro pyridine,3-chloro-pyridine,3-chloropyridine,3-chloranylpyridine PubChem CID: 12287 IUPAC Name: 3-chloropyridine SMILES: ClC1=CC=CN=C1
| PubChem CID | 12287 |
|---|---|
| CAS | 626-60-8 |
| Molecular Weight (g/mol) | 113.54 |
| MDL Number | MFCD00006375 |
| SMILES | ClC1=CC=CN=C1 |
| Synonym | pyridine, 3-chloro,m-chloropyridine,unii-1m13huc1p4,ccris 1715,chloropyridine,b-chloropyridine,3-chloro pyridine,3-chloro-pyridine,3-chloropyridine,3-chloranylpyridine |
| IUPAC Name | 3-chloropyridine |
| InChI Key | PWRBCZZQRRPXAB-UHFFFAOYSA-N |
| Molecular Formula | C5H4ClN |
(±)-Epichlorohydrin, 99%
CAS: 106-89-8 Molecular Formula: C3H5ClO Molecular Weight (g/mol): 92.522 MDL Number: MFCD00005132 InChI Key: BRLQWZUYTZBJKN-UHFFFAOYSA-N Synonym: epichlorohydrin,2-chloromethyl oxirane,epichlorhydrin,1-chloro-2,3-epoxypropane,glycidyl chloride,oxirane, chloromethyl,epichlorhydrine,1,2-epoxy-3-chloropropane,2,3-epoxypropyl chloride,chloropropylene oxide PubChem CID: 7835 ChEBI: CHEBI:37144 IUPAC Name: 2-(chloromethyl)oxirane SMILES: C1C(O1)CCl
| PubChem CID | 7835 |
|---|---|
| CAS | 106-89-8 |
| Molecular Weight (g/mol) | 92.522 |
| ChEBI | CHEBI:37144 |
| MDL Number | MFCD00005132 |
| SMILES | C1C(O1)CCl |
| Synonym | epichlorohydrin,2-chloromethyl oxirane,epichlorhydrin,1-chloro-2,3-epoxypropane,glycidyl chloride,oxirane, chloromethyl,epichlorhydrine,1,2-epoxy-3-chloropropane,2,3-epoxypropyl chloride,chloropropylene oxide |
| IUPAC Name | 2-(chloromethyl)oxirane |
| InChI Key | BRLQWZUYTZBJKN-UHFFFAOYSA-N |
| Molecular Formula | C3H5ClO |
N-(2-Hydroxyethyl)hexamethyleneimine, 95%
CAS: 20603-00-3 Molecular Formula: C8H17NO Molecular Weight (g/mol): 143.23 MDL Number: MFCD00020988 InChI Key: VMRYMOMQCYSPHS-UHFFFAOYSA-N Synonym: 2-azepan-1-yl ethanol,hexahydro-1h-azepine-1-ethanol,n-2-hydroxyethyl hexamethyleneimine,2-azepan-1-yl ethan-1-ol,2-hexamethyleneimino ethanol,2-azaperhydroepinylethan-1-ol,2-azepan-1-ylethan-1-ol,2-azepan-1-yl ;ethanol,2-n-hexamethyleneimino ethanol,1-2-hydroxyethyl homopiperidine PubChem CID: 88615 IUPAC Name: 2-(azepan-1-yl)ethanol SMILES: C1CCCN(CC1)CCO
| PubChem CID | 88615 |
|---|---|
| CAS | 20603-00-3 |
| Molecular Weight (g/mol) | 143.23 |
| MDL Number | MFCD00020988 |
| SMILES | C1CCCN(CC1)CCO |
| Synonym | 2-azepan-1-yl ethanol,hexahydro-1h-azepine-1-ethanol,n-2-hydroxyethyl hexamethyleneimine,2-azepan-1-yl ethan-1-ol,2-hexamethyleneimino ethanol,2-azaperhydroepinylethan-1-ol,2-azepan-1-ylethan-1-ol,2-azepan-1-yl ;ethanol,2-n-hexamethyleneimino ethanol,1-2-hydroxyethyl homopiperidine |
| IUPAC Name | 2-(azepan-1-yl)ethanol |
| InChI Key | VMRYMOMQCYSPHS-UHFFFAOYSA-N |
| Molecular Formula | C8H17NO |
Trityl Chloride 98.0+%, TCI America™
CAS: 76-83-5 Molecular Formula: C19H15Cl Molecular Weight (g/mol): 278.78 MDL Number: MFCD00000813,MFCD00284810 InChI Key: JBWKIWSBJXDJDT-UHFFFAOYSA-N Synonym: trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris PubChem CID: 6456 IUPAC Name: (chlorodiphenylmethyl)benzene SMILES: ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6456 |
|---|---|
| CAS | 76-83-5 |
| Molecular Weight (g/mol) | 278.78 |
| MDL Number | MFCD00000813,MFCD00284810 |
| SMILES | ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris |
| IUPAC Name | (chlorodiphenylmethyl)benzene |
| InChI Key | JBWKIWSBJXDJDT-UHFFFAOYSA-N |
| Molecular Formula | C19H15Cl |
Methyl 2-Iodobenzoate 98.0+%, TCI America™
CAS: 610-97-9 Molecular Formula: C8H7IO2 Molecular Weight (g/mol): 262.046 MDL Number: MFCD00016351 InChI Key: BXXLTVBTDZXPTN-UHFFFAOYSA-N Synonym: 2-iodobenzoic acid methyl ester,methyl o-iodobenzoate,methyl-2-iodobenzoate,benzoic acid, 2-iodo-, methyl ester,2-iodo-benzoic acid methyl ester,methyl2-iodobenzoate,benzoic acid, o-iodo-, methyl ester,methyl 2-iodo-benzoate,pubchem10568,acmc-209mp0 PubChem CID: 69132 IUPAC Name: methyl 2-iodobenzoate SMILES: COC(=O)C1=CC=CC=C1I
| PubChem CID | 69132 |
|---|---|
| CAS | 610-97-9 |
| Molecular Weight (g/mol) | 262.046 |
| MDL Number | MFCD00016351 |
| SMILES | COC(=O)C1=CC=CC=C1I |
| Synonym | 2-iodobenzoic acid methyl ester,methyl o-iodobenzoate,methyl-2-iodobenzoate,benzoic acid, 2-iodo-, methyl ester,2-iodo-benzoic acid methyl ester,methyl2-iodobenzoate,benzoic acid, o-iodo-, methyl ester,methyl 2-iodo-benzoate,pubchem10568,acmc-209mp0 |
| IUPAC Name | methyl 2-iodobenzoate |
| InChI Key | BXXLTVBTDZXPTN-UHFFFAOYSA-N |
| Molecular Formula | C8H7IO2 |
Hydroxylamine-O-sulfonic acid, 97%
CAS: 2950-43-8 Molecular Formula: H3NO4S Molecular Weight (g/mol): 113.09 MDL Number: MFCD00011604 InChI Key: DQPBABKTKYNPMH-UHFFFAOYSA-N Synonym: hydroxylamine-o-sulfonic acid,aminooxy sulfonic acid,sulfoperamidic acid,hydroxylamine-o-sulphonic acid,permonosulfamic acid,amidoperoxymonosulfuric acid,aminooxysulfonic acid,amidosulfonic peracid,haos,sulfamic acid n-oxide PubChem CID: 76284 IUPAC Name: amino hydrogen sulfate SMILES: NOS(O)(=O)=O
| PubChem CID | 76284 |
|---|---|
| CAS | 2950-43-8 |
| Molecular Weight (g/mol) | 113.09 |
| MDL Number | MFCD00011604 |
| SMILES | NOS(O)(=O)=O |
| Synonym | hydroxylamine-o-sulfonic acid,aminooxy sulfonic acid,sulfoperamidic acid,hydroxylamine-o-sulphonic acid,permonosulfamic acid,amidoperoxymonosulfuric acid,aminooxysulfonic acid,amidosulfonic peracid,haos,sulfamic acid n-oxide |
| IUPAC Name | amino hydrogen sulfate |
| InChI Key | DQPBABKTKYNPMH-UHFFFAOYSA-N |
| Molecular Formula | H3NO4S |
Pirenzepine dihydrochloride, 99%
CAS: 29868-97-1 Molecular Formula: C19H23Cl2N5O2 Molecular Weight (g/mol): 424.326 MDL Number: MFCD00055214 InChI Key: FFNMBRCFFADNAO-UHFFFAOYSA-N Synonym: pirenzepine dihydrochloride,pirenzepine hydrochloride,tabe,bisvanil,leblon,maghen,pirenzepine hcl,pirenzepine 2hcl,ls 519 dihydrochloride,unii-10ym403fls PubChem CID: 71405 ChEBI: CHEBI:32014 IUPAC Name: 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride SMILES: CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl
| PubChem CID | 71405 |
|---|---|
| CAS | 29868-97-1 |
| Molecular Weight (g/mol) | 424.326 |
| ChEBI | CHEBI:32014 |
| MDL Number | MFCD00055214 |
| SMILES | CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl |
| Synonym | pirenzepine dihydrochloride,pirenzepine hydrochloride,tabe,bisvanil,leblon,maghen,pirenzepine hcl,pirenzepine 2hcl,ls 519 dihydrochloride,unii-10ym403fls |
| IUPAC Name | 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride |
| InChI Key | FFNMBRCFFADNAO-UHFFFAOYSA-N |
| Molecular Formula | C19H23Cl2N5O2 |
Isophthalic acid, 99%
CAS: 121-91-5 Molecular Formula: C8H6O4 Molecular Weight (g/mol): 166.132 MDL Number: MFCD00002516 InChI Key: QQVIHTHCMHWDBS-UHFFFAOYSA-N Synonym: isophthalic acid,1,3-benzenedicarboxylic acid,m-phthalic acid,m-benzenedicarboxylic acid,acide isophtalique,kyselina isoftalova,iso-phthalic acid,acide isophtalique french,kyselina isoftalova czech,unii-x35216h9fj PubChem CID: 8496 ChEBI: CHEBI:30802 IUPAC Name: benzene-1,3-dicarboxylic acid SMILES: C1=CC(=CC(=C1)C(=O)O)C(=O)O
| PubChem CID | 8496 |
|---|---|
| CAS | 121-91-5 |
| Molecular Weight (g/mol) | 166.132 |
| ChEBI | CHEBI:30802 |
| MDL Number | MFCD00002516 |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(=O)O |
| Synonym | isophthalic acid,1,3-benzenedicarboxylic acid,m-phthalic acid,m-benzenedicarboxylic acid,acide isophtalique,kyselina isoftalova,iso-phthalic acid,acide isophtalique french,kyselina isoftalova czech,unii-x35216h9fj |
| IUPAC Name | benzene-1,3-dicarboxylic acid |
| InChI Key | QQVIHTHCMHWDBS-UHFFFAOYSA-N |
| Molecular Formula | C8H6O4 |
Diethyl oxalate, 99%
CAS: 95-92-1 Molecular Formula: C6H10O4 Molecular Weight (g/mol): 146.142 MDL Number: MFCD00009119 InChI Key: WYACBZDAHNBPPB-UHFFFAOYSA-N Synonym: ethyl oxalate,diethyl ethanedioate,ethanedioic acid, diethyl ester,oxalic acid, diethyl ester,oxalic ether,diethyloxalate,ethyl oxalate van,oxalic acid diethyl ester,unii-860m3zwf6j,diethylester kyseliny stavelove PubChem CID: 7268 IUPAC Name: diethyl oxalate SMILES: CCOC(=O)C(=O)OCC
| PubChem CID | 7268 |
|---|---|
| CAS | 95-92-1 |
| Molecular Weight (g/mol) | 146.142 |
| MDL Number | MFCD00009119 |
| SMILES | CCOC(=O)C(=O)OCC |
| Synonym | ethyl oxalate,diethyl ethanedioate,ethanedioic acid, diethyl ester,oxalic acid, diethyl ester,oxalic ether,diethyloxalate,ethyl oxalate van,oxalic acid diethyl ester,unii-860m3zwf6j,diethylester kyseliny stavelove |
| IUPAC Name | diethyl oxalate |
| InChI Key | WYACBZDAHNBPPB-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
4-Nitrophenyl chloroformate, 97%
CAS: 7693-46-1 Molecular Formula: C7H4ClNO4 Molecular Weight (g/mol): 201.562 MDL Number: MFCD00007321 InChI Key: NXLNNXIXOYSCMB-UHFFFAOYSA-N Synonym: 4-nitrophenyl chloroformate,carbonochloridic acid, 4-nitrophenyl ester,chloroformic acid 4-nitrophenyl ester,p-nitrophenyl chloroformate,chloroformic acid p-nitrophenyl ester,4-nitrophenyl carbonochloridate,formic acid, chloro-, p-nitrophenyl ester,4-nitrophenylchlorocarbonat,4-nitrophenyl choroformate PubChem CID: 82129 IUPAC Name: (4-nitrophenyl) carbonochloridate SMILES: C1=CC(=CC=C1[N+](=O)[O-])OC(=O)Cl
| PubChem CID | 82129 |
|---|---|
| CAS | 7693-46-1 |
| Molecular Weight (g/mol) | 201.562 |
| MDL Number | MFCD00007321 |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)Cl |
| Synonym | 4-nitrophenyl chloroformate,carbonochloridic acid, 4-nitrophenyl ester,chloroformic acid 4-nitrophenyl ester,p-nitrophenyl chloroformate,chloroformic acid p-nitrophenyl ester,4-nitrophenyl carbonochloridate,formic acid, chloro-, p-nitrophenyl ester,4-nitrophenylchlorocarbonat,4-nitrophenyl choroformate |
| IUPAC Name | (4-nitrophenyl) carbonochloridate |
| InChI Key | NXLNNXIXOYSCMB-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO4 |
2-Hydroxy-1-naphthaldehyde, 98%
CAS: 708-06-5 Molecular Formula: C11H8O2 Molecular Weight (g/mol): 172.183 MDL Number: MFCD00004005 InChI Key: NTCCNERMXRIPTR-UHFFFAOYSA-N Synonym: 2-hydroxy-1-naphthaldehyde,1-formyl-2-naphthol,2-hydroxy-1-naphthylaldehyde,2-hydroxy-1-napthaldehyde,2-hydroxynaphthaldehyde,2-naphthol 1-carboxaldehyde,2-hydroxy-1-naphthalaldehyde,1-naphthalenecarboxaldehyde, 2-hydroxy,2-hydroxy-1-naphthalenecarboxaldehyde,1-hydroxy-2-naphthalenecarboxaldehyde PubChem CID: 12819 IUPAC Name: 2-hydroxynaphthalene-1-carbaldehyde SMILES: C1=CC=C2C(=C1)C=CC(=C2C=O)O
| PubChem CID | 12819 |
|---|---|
| CAS | 708-06-5 |
| Molecular Weight (g/mol) | 172.183 |
| MDL Number | MFCD00004005 |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C=O)O |
| Synonym | 2-hydroxy-1-naphthaldehyde,1-formyl-2-naphthol,2-hydroxy-1-naphthylaldehyde,2-hydroxy-1-napthaldehyde,2-hydroxynaphthaldehyde,2-naphthol 1-carboxaldehyde,2-hydroxy-1-naphthalaldehyde,1-naphthalenecarboxaldehyde, 2-hydroxy,2-hydroxy-1-naphthalenecarboxaldehyde,1-hydroxy-2-naphthalenecarboxaldehyde |
| IUPAC Name | 2-hydroxynaphthalene-1-carbaldehyde |
| InChI Key | NTCCNERMXRIPTR-UHFFFAOYSA-N |
| Molecular Formula | C11H8O2 |