Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
N-Acetyl-D-Glucosamine, Cell Culture Reagent, 100%, MP Biomedicals™
CAS: 7512-17-6 Molecular Formula: C8H15NO6 Molecular Weight (g/mol): 221.21 MDL Number: MFCD00061615 InChI Key: OVRNDRQMDRJTHS-WZWLWIOANA-N Synonym: 2-Acetamido-2-deoxy-D-glucose IUPAC Name: N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide SMILES: CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O
| CAS | 7512-17-6 |
|---|---|
| Molecular Weight (g/mol) | 221.21 |
| MDL Number | MFCD00061615 |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| Synonym | 2-Acetamido-2-deoxy-D-glucose |
| IUPAC Name | N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| InChI Key | OVRNDRQMDRJTHS-WZWLWIOANA-N |
| Molecular Formula | C8H15NO6 |
L-Cystine disodium salt, 98+%
CAS: 64704-23-0 Molecular Formula: C6H10N2Na2O4S2 Molecular Weight (g/mol): 284.26 MDL Number: MFCD00037206 InChI Key: PLVPMKWGXOOSKL-UHFFFAOYNA-L Synonym: disodium 2-amino-3-2r-2-amino-2-carboxylatoethyl disulfanyl propanoate PubChem CID: 71607258 IUPAC Name: disodium;2-amino-3-[[(2R)-2-amino-2-carboxylatoethyl]disulfanyl]propanoate SMILES: [Na+].[Na+].NC(CSSCC(N)C([O-])=O)C([O-])=O
| PubChem CID | 71607258 |
|---|---|
| CAS | 64704-23-0 |
| Molecular Weight (g/mol) | 284.26 |
| MDL Number | MFCD00037206 |
| SMILES | [Na+].[Na+].NC(CSSCC(N)C([O-])=O)C([O-])=O |
| Synonym | disodium 2-amino-3-2r-2-amino-2-carboxylatoethyl disulfanyl propanoate |
| IUPAC Name | disodium;2-amino-3-[[(2R)-2-amino-2-carboxylatoethyl]disulfanyl]propanoate |
| InChI Key | PLVPMKWGXOOSKL-UHFFFAOYNA-L |
| Molecular Formula | C6H10N2Na2O4S2 |
Ethyl 2-mercaptoacetate, 99%
CAS: 623-51-8 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.17 MDL Number: MFCD00004874 InChI Key: PVBRSNZAOAJRKO-UHFFFAOYSA-N Synonym: ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester PubChem CID: 12185 IUPAC Name: ethyl 2-sulfanylacetate SMILES: CCOC(=O)CS
| PubChem CID | 12185 |
|---|---|
| CAS | 623-51-8 |
| Molecular Weight (g/mol) | 120.17 |
| MDL Number | MFCD00004874 |
| SMILES | CCOC(=O)CS |
| Synonym | ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester |
| IUPAC Name | ethyl 2-sulfanylacetate |
| InChI Key | PVBRSNZAOAJRKO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
Sulfuric acid, for analysis, ca. 96% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Ethylene glycol diethyl ether, 99%
CAS: 629-14-1 Molecular Formula: C6H14O2 Molecular Weight (g/mol): 118.18 MDL Number: MFCD00009253 InChI Key: LZDKZFUFMNSQCJ-UHFFFAOYSA-N Synonym: ethylene glycol diethyl ether,diethyl cellosolve,ethane, 1,2-diethoxy,hisolve eme,3,6-dioxaoctane,glyme-1,diethyl glycol,2-ethoxyethyl ethyl ether,egdee,diethylether ethylenglykolu PubChem CID: 12375 IUPAC Name: 1,2-diethoxyethane SMILES: CCOCCOCC
| PubChem CID | 12375 |
|---|---|
| CAS | 629-14-1 |
| Molecular Weight (g/mol) | 118.18 |
| MDL Number | MFCD00009253 |
| SMILES | CCOCCOCC |
| Synonym | ethylene glycol diethyl ether,diethyl cellosolve,ethane, 1,2-diethoxy,hisolve eme,3,6-dioxaoctane,glyme-1,diethyl glycol,2-ethoxyethyl ethyl ether,egdee,diethylether ethylenglykolu |
| IUPAC Name | 1,2-diethoxyethane |
| InChI Key | LZDKZFUFMNSQCJ-UHFFFAOYSA-N |
| Molecular Formula | C6H14O2 |
Thermo Scientific Chemicals Hydroxypropyl cellulose, Average M.W. 100.000
CAS: 9004-64-2 Molecular Formula: (C24H44O16)n MDL Number: MFCD00132688 Synonym: 4-1-aminopropyl-n,n,3-trimethylaniline,4-dimethylamino-alpha,2-dimethylphenethylamine,benzeneethanamine, 4-dimethylamino-alpha,2-dimethyl,amiflamin,55875-51-9 di-hydrochloride,hydroxypropyl cellulose, m.w. 100,000,4-1-aminopropyl-n,n,3-trimethyl-aniline,hydroxypropyl cellulose 6-10 mpa?s in water at 20 ?c,hydroxypropyl cellulose, 3-6 mpa?s in water at 20 ?c
| CAS | 9004-64-2 |
|---|---|
| MDL Number | MFCD00132688 |
| Synonym | 4-1-aminopropyl-n,n,3-trimethylaniline,4-dimethylamino-alpha,2-dimethylphenethylamine,benzeneethanamine, 4-dimethylamino-alpha,2-dimethyl,amiflamin,55875-51-9 di-hydrochloride,hydroxypropyl cellulose, m.w. 100,000,4-1-aminopropyl-n,n,3-trimethyl-aniline,hydroxypropyl cellulose 6-10 mpa?s in water at 20 ?c,hydroxypropyl cellulose, 3-6 mpa?s in water at 20 ?c |
| Molecular Formula | (C24H44O16)n |
Semicarbazide hydrochloride, 99+%
CAS: 563-41-7 Molecular Formula: CH6ClN3O Molecular Weight (g/mol): 111.53 MDL Number: MFCD00013009 InChI Key: XHQYBDSXTDXSHY-UHFFFAOYSA-N Synonym: semicarbazide hydrochloride,aminourea hydrochloride,semicarbazide hcl,hydrazinecarboxamide hydrochloride,hydrazinecarboxamide, monohydrochloride,semicarbazide chloride,amidourea hydrochloride,carbamylhydrazine hydrochloride,semicarbazide monohydrochloride,semicarbazide, monohydrochloride PubChem CID: 11236 ChEBI: CHEBI:82532 IUPAC Name: aminourea;hydrochloride SMILES: [H+].[Cl-].NNC(N)=O
| PubChem CID | 11236 |
|---|---|
| CAS | 563-41-7 |
| Molecular Weight (g/mol) | 111.53 |
| ChEBI | CHEBI:82532 |
| MDL Number | MFCD00013009 |
| SMILES | [H+].[Cl-].NNC(N)=O |
| Synonym | semicarbazide hydrochloride,aminourea hydrochloride,semicarbazide hcl,hydrazinecarboxamide hydrochloride,hydrazinecarboxamide, monohydrochloride,semicarbazide chloride,amidourea hydrochloride,carbamylhydrazine hydrochloride,semicarbazide monohydrochloride,semicarbazide, monohydrochloride |
| IUPAC Name | aminourea;hydrochloride |
| InChI Key | XHQYBDSXTDXSHY-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3O |
Thermo Scientific Chemicals N,N,N',N'-Tetramethyl-p-phenylenediamine dihydrochloride, 98+%
CAS: 637-01-4 Molecular Formula: C10H16N2·2HCl Molecular Weight (g/mol): 237.17 MDL Number: MFCD00012482 InChI Key: FBHKTSXMTASXFJ-UHFFFAOYSA-N Synonym: n,n,n',n'-tetramethyl-p-phenylenediamine dihydrochloride,wurster's reagent dihydrochloride,n,n,n',n'-tetramethyl-1,4-phenylenediamine dihydrochloride,unii-66w8hka51x,n1,n1,n4,n4-tetramethylbenzene-1,4-diamine dihydrochloride,wurster's blue dihydrochloride,1,4-benzenediamine, n,n,n',n'-tetramethyl-, dihydrochloride,1,4-benzenediamine, n1,n1,n4,n4-tetramethyl-, hydrochloride 1:2,1-n,1-n,4-n,4-n-tetramethylbenzene-1,4-diamine dihydrochloride,wursters reagent PubChem CID: 71561 IUPAC Name: 1-N,1-N,4-N,4-N-tetramethylbenzene-1,4-diamine;dihydrochloride SMILES: CN(C)C1=CC=C(C=C1)N(C)C.Cl.Cl
| PubChem CID | 71561 |
|---|---|
| CAS | 637-01-4 |
| Molecular Weight (g/mol) | 237.17 |
| MDL Number | MFCD00012482 |
| SMILES | CN(C)C1=CC=C(C=C1)N(C)C.Cl.Cl |
| Synonym | n,n,n',n'-tetramethyl-p-phenylenediamine dihydrochloride,wurster's reagent dihydrochloride,n,n,n',n'-tetramethyl-1,4-phenylenediamine dihydrochloride,unii-66w8hka51x,n1,n1,n4,n4-tetramethylbenzene-1,4-diamine dihydrochloride,wurster's blue dihydrochloride,1,4-benzenediamine, n,n,n',n'-tetramethyl-, dihydrochloride,1,4-benzenediamine, n1,n1,n4,n4-tetramethyl-, hydrochloride 1:2,1-n,1-n,4-n,4-n-tetramethylbenzene-1,4-diamine dihydrochloride,wursters reagent |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetramethylbenzene-1,4-diamine;dihydrochloride |
| InChI Key | FBHKTSXMTASXFJ-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2·2HCl |
Ethyl trifluoroacetate, 99%
CAS: 383-63-1 Molecular Formula: C4H5F3O2 Molecular Weight (g/mol): 142.08 MDL Number: MFCD00000419 InChI Key: STSCVKRWJPWALQ-UHFFFAOYSA-N Synonym: ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid PubChem CID: 9794 IUPAC Name: ethyl 2,2,2-trifluoroacetate SMILES: CCOC(=O)C(F)(F)F
| PubChem CID | 9794 |
|---|---|
| CAS | 383-63-1 |
| Molecular Weight (g/mol) | 142.08 |
| MDL Number | MFCD00000419 |
| SMILES | CCOC(=O)C(F)(F)F |
| Synonym | ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate |
| InChI Key | STSCVKRWJPWALQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3O2 |
Thymine, 99%
CAS: 65-71-4 Molecular Formula: C5H6N2O2 Molecular Weight (g/mol): 126.11 MDL Number: MFCD00006026 InChI Key: RWQNBRDOKXIBIV-UHFFFAOYSA-N Synonym: thymine,5-methyluracil,thymin,2,4-dihydroxy-5-methylpyrimidine,thymine anhydrate,2,4 1h,3h-pyrimidinedione, 5-methyl,5-methylpyrimidine-2,4 1h,3h-dione,5-methyl-2,4 1h,3h-pyrimidinedione,thymin purine base,5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione PubChem CID: 1135 ChEBI: CHEBI:17821 IUPAC Name: 5-methyl-1H-pyrimidine-2,4-dione SMILES: CC1=CNC(=O)NC1=O
| PubChem CID | 1135 |
|---|---|
| CAS | 65-71-4 |
| Molecular Weight (g/mol) | 126.11 |
| ChEBI | CHEBI:17821 |
| MDL Number | MFCD00006026 |
| SMILES | CC1=CNC(=O)NC1=O |
| Synonym | thymine,5-methyluracil,thymin,2,4-dihydroxy-5-methylpyrimidine,thymine anhydrate,2,4 1h,3h-pyrimidinedione, 5-methyl,5-methylpyrimidine-2,4 1h,3h-dione,5-methyl-2,4 1h,3h-pyrimidinedione,thymin purine base,5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione |
| InChI Key | RWQNBRDOKXIBIV-UHFFFAOYSA-N |
| Molecular Formula | C5H6N2O2 |
N-(Benzyloxycarbonyloxy)succinimide, 98%
CAS: 13139-17-8 Molecular Formula: C12H11NO5 Molecular Weight (g/mol): 249.222 MDL Number: MFCD00005513 InChI Key: MJSHDCCLFGOEIK-UHFFFAOYSA-N Synonym: n-benzyloxycarbonyloxy succinimide,cbz-osu,cbz-onsu,benzyl 2,5-dioxopyrrolidin-1-yl carbonate,benzyl succinimido carbonate,z-osu,n-carbobenzoxyoxysuccinimide,n-benzyloxycarbonyloxy-succinimide,cbzosu,carbobenzoxy succinimide PubChem CID: 83172 IUPAC Name: benzyl (2,5-dioxopyrrolidin-1-yl) carbonate SMILES: C1CC(=O)N(C1=O)OC(=O)OCC2=CC=CC=C2
| PubChem CID | 83172 |
|---|---|
| CAS | 13139-17-8 |
| Molecular Weight (g/mol) | 249.222 |
| MDL Number | MFCD00005513 |
| SMILES | C1CC(=O)N(C1=O)OC(=O)OCC2=CC=CC=C2 |
| Synonym | n-benzyloxycarbonyloxy succinimide,cbz-osu,cbz-onsu,benzyl 2,5-dioxopyrrolidin-1-yl carbonate,benzyl succinimido carbonate,z-osu,n-carbobenzoxyoxysuccinimide,n-benzyloxycarbonyloxy-succinimide,cbzosu,carbobenzoxy succinimide |
| IUPAC Name | benzyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChI Key | MJSHDCCLFGOEIK-UHFFFAOYSA-N |
| Molecular Formula | C12H11NO5 |
meso-Tetrakis(4-methoxyphenyl)porphine, 95%
CAS: 22112-78-3 Molecular Formula: C48H38N4O4 Molecular Weight (g/mol): 734.856 MDL Number: MFCD09909566 InChI Key: SKXWDGDNWBYACJ-UHFFFAOYSA-N Synonym: 5,10,15,20-tetrakis 4-methoxyphenyl-21h,23h-porphine,5,10,15,20-tetrakis 4-methoxyphenyl porphyrin,tetra p-methoxyphenyl porphyrin,21h,23h-porphine, 5,10,15,20-tetrakis 4-methoxyphenyl,5,10,15,20-tetrakis 4-methoxyphenyl-21,22-dihydroporphyrin,2,7,12,17-tetrakis 4-methoxyphenyl-21,22,23,24-tetraazapentacyclo 16.2.1.1 3 ,?.1?, 1 1 .1 1 3 , 1 ? tetracosa-1,3,5,7,9,11 23 ,12,14,16,18 21 ,19-undecaene,4-methoxy-1-7,12,17-tris 4-methoxyphenyl-21,22,23,24-tetraazapentacyclo 16.2 .1.1<3,6>.1<8,11>.1<13,16> tetracosa-1,3,5,7,9,11 23 ,12,14,16,18 21 ,19-undec aen-2-yl benzene,acmc-209fs6,tetrakis p-methoxyphenyl porphyrin,meso-tetra 4-methoxyphenyl porphine PubChem CID: 140886 IUPAC Name: 5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin SMILES: COC1=CC=C(C=C1)C2=C3C=CC(=C(C4=CC=C(N4)C(=C5C=CC(=N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)C9=CC=C(C=C9)OC)N3
| PubChem CID | 140886 |
|---|---|
| CAS | 22112-78-3 |
| Molecular Weight (g/mol) | 734.856 |
| MDL Number | MFCD09909566 |
| SMILES | COC1=CC=C(C=C1)C2=C3C=CC(=C(C4=CC=C(N4)C(=C5C=CC(=N5)C(=C6C=CC2=N6)C7=CC=C(C=C7)OC)C8=CC=C(C=C8)OC)C9=CC=C(C=C9)OC)N3 |
| Synonym | 5,10,15,20-tetrakis 4-methoxyphenyl-21h,23h-porphine,5,10,15,20-tetrakis 4-methoxyphenyl porphyrin,tetra p-methoxyphenyl porphyrin,21h,23h-porphine, 5,10,15,20-tetrakis 4-methoxyphenyl,5,10,15,20-tetrakis 4-methoxyphenyl-21,22-dihydroporphyrin,2,7,12,17-tetrakis 4-methoxyphenyl-21,22,23,24-tetraazapentacyclo 16.2.1.1 3 ,?.1?, 1 1 .1 1 3 , 1 ? tetracosa-1,3,5,7,9,11 23 ,12,14,16,18 21 ,19-undecaene,4-methoxy-1-7,12,17-tris 4-methoxyphenyl-21,22,23,24-tetraazapentacyclo 16.2 .1.1<3,6>.1<8,11>.1<13,16> tetracosa-1,3,5,7,9,11 23 ,12,14,16,18 21 ,19-undec aen-2-yl benzene,acmc-209fs6,tetrakis p-methoxyphenyl porphyrin,meso-tetra 4-methoxyphenyl porphine |
| IUPAC Name | 5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin |
| InChI Key | SKXWDGDNWBYACJ-UHFFFAOYSA-N |
| Molecular Formula | C48H38N4O4 |
Benzotrifluoride, 99%
CAS: 98-08-8 Molecular Formula: C7H5F3 Molecular Weight (g/mol): 146.112 MDL Number: MFCD00000372 InChI Key: GETTZEONDQJALK-UHFFFAOYSA-N Synonym: benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene PubChem CID: 7368 ChEBI: CHEBI:36810 IUPAC Name: trifluoromethylbenzene SMILES: C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 7368 |
|---|---|
| CAS | 98-08-8 |
| Molecular Weight (g/mol) | 146.112 |
| ChEBI | CHEBI:36810 |
| MDL Number | MFCD00000372 |
| SMILES | C1=CC=C(C=C1)C(F)(F)F |
| Synonym | benzotrifluoride,trifluoromethyl benzene,alpha,alpha,alpha-trifluorotoluene,phenylfluoroform,benzene, trifluoromethyl,benzenyl fluoride,benzylidyne fluoride,usaf ma-16,a,a,a-trifluorotoluene,trifluoro toluene |
| IUPAC Name | trifluoromethylbenzene |
| InChI Key | GETTZEONDQJALK-UHFFFAOYSA-N |
| Molecular Formula | C7H5F3 |
Tetra-n-butylammonium hydroxide, 55% w/w aq. soln.
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 PubChem CID: 2723671 SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |
4'-Hydroxyacetophenone, 99%
CAS: 99-93-4 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002359 InChI Key: TXFPEBPIARQUIG-UHFFFAOYSA-N Synonym: 4'-hydroxyacetophenone,4-hydroxyacetophenone,1-4-hydroxyphenyl ethanone,4-acetylphenol,p-hydroxyacetophenone,piceol,ethanone, 1-4-hydroxyphenyl,p-acetylphenol,para-hydroxyacetophenone,p-oxyacetophenone PubChem CID: 7469 ChEBI: CHEBI:28032 IUPAC Name: 1-(4-hydroxyphenyl)ethanone SMILES: CC(=O)C1=CC=C(O)C=C1
| PubChem CID | 7469 |
|---|---|
| CAS | 99-93-4 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:28032 |
| MDL Number | MFCD00002359 |
| SMILES | CC(=O)C1=CC=C(O)C=C1 |
| Synonym | 4'-hydroxyacetophenone,4-hydroxyacetophenone,1-4-hydroxyphenyl ethanone,4-acetylphenol,p-hydroxyacetophenone,piceol,ethanone, 1-4-hydroxyphenyl,p-acetylphenol,para-hydroxyacetophenone,p-oxyacetophenone |
| IUPAC Name | 1-(4-hydroxyphenyl)ethanone |
| InChI Key | TXFPEBPIARQUIG-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |